C20H11Cl2N3O4 — CID 55512414
(1-cyanoindolizin-2-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 55512414) has the molecular formula C20H11Cl2N3O4 and a molecular weight of 428.23 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55512414 |
| Molecular Formula | C20H11Cl2N3O4 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | N#Cc1c(COC(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cn2ccccc12 |
| InChI | InChI=1S/C20H11Cl2N3O4/c21-15-5-12-13(6-16(15)22)20(28)25(19(12)27)9-18(26)29-10-11-8-24-4-2-1-3-17(24)14(11)7-23/h1-6,8H,9-10H2 |
| InChIKey | GPOSBWFMPCWFND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|