About 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate
3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate (PubChem CID 2349365) has the molecular formula C26H20Cl2N2O4
and a molecular weight of 495.36 g/mol. Its IUPAC name is 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate.
Molecular Properties
| Compound Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate |
| PubChem CID | 2349365 |
| Molecular Formula | C26H20Cl2N2O4 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate |
| SMILES | O=C(NCCCOC(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1c(-c2ccccc2)cc2ccccn12 |
| InChI | InChI=1S/C26H20Cl2N2O4/c27-21-11-10-18(15-22(21)28)26(33)34-14-6-12-29-25(32)24(31)23-20(17-7-2-1-3-8-17)16-19-9-4-5-13-30(19)23/h1-5,7-11,13,15-16H,6,12,14H2,(H,29,32) |
| InChIKey | UTKIKKFIHIKCHN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate?
The IUPAC name of 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate (CID 2349365) is 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate.
What is the SMILES notation for 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate?
The canonical SMILES for 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate is O=C(NCCCOC(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1c(-c2ccccc2)cc2ccccn12.
What is the InChIKey of 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate?
The InChIKey is UTKIKKFIHIKCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20Cl2N2O4/c27-21-11-10-18(15-22(21)28)26(33)34-14-6-12-29-25(32)24(31)23-20(17-7-2-1-3-8-17)16-19-9-4-5-13-30(19)23/h1-5,7-11,13,15-16H,6,12,14H2,(H,29,32).
What are the key properties of 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate?
3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate has a molecular weight of 495.36 g/mol, XLogP of 5.46, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate is sourced from PubChem (CID 2349365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).