C26H20Cl2N2O4 — CID 2349365
3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate (PubChem CID 2349365) has the molecular formula C26H20Cl2N2O4 and a molecular weight of 495.36 g/mol. Its IUPAC name is 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate.
| Compound Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2349365 |
| Molecular Formula | C26H20Cl2N2O4 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 3,4-dichlorobenzoate |
| SMILES | O=C(NCCCOC(=O)c1ccc(Cl)c(Cl)c1)C(=O)c1c(-c2ccccc2)cc2ccccn12 |
| InChI | InChI=1S/C26H20Cl2N2O4/c27-21-11-10-18(15-22(21)28)26(33)34-14-6-12-29-25(32)24(31)23-20(17-7-2-1-3-8-17)16-19-9-4-5-13-30(19)23/h1-5,7-11,13,15-16H,6,12,14H2,(H,29,32) |
| InChIKey | UTKIKKFIHIKCHN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|