C26H20ClN3O6 — CID 2353744
3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 4-chloro-2-nitrobenzoate (PubChem CID 2353744) has the molecular formula C26H20ClN3O6 and a molecular weight of 505.91 g/mol. Its IUPAC name is 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 4-chloro-2-nitrobenzoate.
| Compound Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 2353744 |
| Molecular Formula | C26H20ClN3O6 |
| Molecular Weight | 505.91 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]propyl 4-chloro-2-nitrobenzoate |
| SMILES | O=C(NCCCOC(=O)c1ccc(Cl)cc1[N+](=O)[O-])C(=O)c1c(-c2ccccc2)cc2ccccn12 |
| InChI | InChI=1S/C26H20ClN3O6/c27-18-10-11-20(22(15-18)30(34)35)26(33)36-14-6-12-28-25(32)24(31)23-21(17-7-2-1-3-8-17)16-19-9-4-5-13-29(19)23/h1-5,7-11,13,15-16H,6,12,14H2,(H,28,32) |
| InChIKey | JEPKSRRLZHILBN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|