C24H19N3O3 — CID 123824806
N'-acetyl-2-oxo-N'-phenyl-2-(2-phenylindolizin-3-yl)acetohydrazide (PubChem CID 123824806) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N'-acetyl-2-oxo-N'-phenyl-2-(2-phenylindolizin-3-yl)acetohydrazide.
| Compound Name | N'-acetyl-2-oxo-N'-phenyl-2-(2-phenylindolizin-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 123824806 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N'-acetyl-2-oxo-N'-phenyl-2-(2-phenylindolizin-3-yl)acetohydrazide |
| SMILES | CC(=O)N(NC(=O)C(=O)c1c(-c2ccccc2)cc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O3/c1-17(28)27(19-12-6-3-7-13-19)25-24(30)23(29)22-21(18-10-4-2-5-11-18)16-20-14-8-9-15-26(20)22/h2-16H,1H3,(H,25,30) |
| InChIKey | TZYNKXFBRMCPQN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|