C32H29N5O2 — CID 67106374
N-[2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide (PubChem CID 67106374) has the molecular formula C32H29N5O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is N-[2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide.
| Compound Name | N-[2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide |
|---|---|
| PubChem CID | 67106374 |
| Molecular Formula | C32H29N5O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-[2-methyl-4-(4-pyridin-2-ylpiperazin-1-yl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide |
| SMILES | Cc1cc(N2CCN(c3ccccn3)CC2)ccc1NC(=O)C(=O)c1c(-c2ccccc2)cc2ccccn12 |
| InChI | InChI=1S/C32H29N5O2/c1-23-21-25(35-17-19-36(20-18-35)29-12-5-7-15-33-29)13-14-28(23)34-32(39)31(38)30-27(24-9-3-2-4-10-24)22-26-11-6-8-16-37(26)30/h2-16,21-22H,17-20H2,1H3,(H,34,39) |
| InChIKey | WSHARXCSHGCCBE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|