C30H33N5O2 — CID 67106949
N-[4-[4-(4-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide (PubChem CID 67106949) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is N-[4-[4-(4-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide.
| Compound Name | N-[4-[4-(4-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide |
|---|---|
| PubChem CID | 67106949 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | N-[4-[4-(4-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-propan-2-ylindolizin-3-yl)acetamide |
| SMILES | CCc1ccnc(N2CCN(c3ccc(NC(=O)C(=O)c4c(C(C)C)cc5ccccn45)cc3)CC2)c1 |
| InChI | InChI=1S/C30H33N5O2/c1-4-22-12-13-31-27(19-22)34-17-15-33(16-18-34)24-10-8-23(9-11-24)32-30(37)29(36)28-26(21(2)3)20-25-7-5-6-14-35(25)28/h5-14,19-21H,4,15-18H2,1-3H3,(H,32,37) |
| InChIKey | ICMVSQPVRRUAKY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|