C24H18N4O2 — CID 67106521
N-(1-methylbenzimidazol-5-yl)-2-oxo-2-(2-phenylindolizin-3-yl)acetamide (PubChem CID 67106521) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(1-methylbenzimidazol-5-yl)-2-oxo-2-(2-phenylindolizin-3-yl)acetamide.
| Compound Name | N-(1-methylbenzimidazol-5-yl)-2-oxo-2-(2-phenylindolizin-3-yl)acetamide |
|---|---|
| PubChem CID | 67106521 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(1-methylbenzimidazol-5-yl)-2-oxo-2-(2-phenylindolizin-3-yl)acetamide |
| SMILES | Cn1cnc2cc(NC(=O)C(=O)c3c(-c4ccccc4)cc4ccccn34)ccc21 |
| InChI | InChI=1S/C24H18N4O2/c1-27-15-25-20-13-17(10-11-21(20)27)26-24(30)23(29)22-19(16-7-3-2-4-8-16)14-18-9-5-6-12-28(18)22/h2-15H,1H3,(H,26,30) |
| InChIKey | DWTVGGGTVGVQCQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|