C23H18N3O5S- — CID 174605876
[N-methyl-4-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]anilino] sulfite (PubChem CID 174605876) has the molecular formula C23H18N3O5S- and a molecular weight of 448.48 g/mol. Its IUPAC name is [N-methyl-4-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]anilino] sulfite.
| Compound Name | [N-methyl-4-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]anilino] sulfite |
|---|---|
| PubChem CID | 174605876 |
| Molecular Formula | C23H18N3O5S- |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [N-methyl-4-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]anilino] sulfite |
| SMILES | CN(OS(=O)[O-])c1ccc(NC(=O)C(=O)c2c(-c3ccccc3)cc3ccccn23)cc1 |
| InChI | InChI=1S/C23H19N3O5S/c1-25(31-32(29)30)18-12-10-17(11-13-18)24-23(28)22(27)21-20(16-7-3-2-4-8-16)15-19-9-5-6-14-26(19)21/h2-15H,1H3,(H,24,28)(H,29,30)/p-1 |
| InChIKey | XLMQIWGZWJNQDM-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|