C33H33N5O3 — CID 67326755
N-[4-[2-[(4,6-dimethyl-2-pyridinyl)amino]ethyl-methylamino]phenyl]-2-(6-methoxy-2-phenylindolizin-3-yl)-2-oxoacetamide (PubChem CID 67326755) has the molecular formula C33H33N5O3 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[4-[2-[(4,6-dimethyl-2-pyridinyl)amino]ethyl-methylamino]phenyl]-2-(6-methoxy-2-phenylindolizin-3-yl)-2-oxoacetamide.
| Compound Name | N-[4-[2-[(4,6-dimethyl-2-pyridinyl)amino]ethyl-methylamino]phenyl]-2-(6-methoxy-2-phenylindolizin-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 67326755 |
| Molecular Formula | C33H33N5O3 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | N-[4-[2-[(4,6-dimethyl-2-pyridinyl)amino]ethyl-methylamino]phenyl]-2-(6-methoxy-2-phenylindolizin-3-yl)-2-oxoacetamide |
| SMILES | COc1ccc2cc(-c3ccccc3)c(C(=O)C(=O)Nc3ccc(N(C)CCNc4cc(C)cc(C)n4)cc3)n2c1 |
| InChI | InChI=1S/C33H33N5O3/c1-22-18-23(2)35-30(19-22)34-16-17-37(3)26-12-10-25(11-13-26)36-33(40)32(39)31-29(24-8-6-5-7-9-24)20-27-14-15-28(41-4)21-38(27)31/h5-15,18-21H,16-17H2,1-4H3,(H,34,35)(H,36,40) |
| InChIKey | PWNJBKNBACPSHO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|