C23H16N2O4 — CID 68828260
3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]benzoic acid (PubChem CID 68828260) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68828260 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-[[2-oxo-2-(2-phenylindolizin-3-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(Nc1cccc(C(=O)O)c1)C(=O)c1c(-c2ccccc2)cc2ccccn12 |
| InChI | InChI=1S/C23H16N2O4/c26-21(22(27)24-17-10-6-9-16(13-17)23(28)29)20-19(15-7-2-1-3-8-15)14-18-11-4-5-12-25(18)20/h1-14H,(H,24,27)(H,28,29) |
| InChIKey | VHYGSFXPAZSMKX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|