C24H20N2O3 — CID 67106871
N-[4-(1-hydroxyethyl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide (PubChem CID 67106871) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[4-(1-hydroxyethyl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide.
| Compound Name | N-[4-(1-hydroxyethyl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide |
|---|---|
| PubChem CID | 67106871 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[4-(1-hydroxyethyl)phenyl]-2-oxo-2-(2-phenylindolizin-3-yl)acetamide |
| SMILES | CC(O)c1ccc(NC(=O)C(=O)c2c(-c3ccccc3)cc3ccccn23)cc1 |
| InChI | InChI=1S/C24H20N2O3/c1-16(27)17-10-12-19(13-11-17)25-24(29)23(28)22-21(18-7-3-2-4-8-18)15-20-9-5-6-14-26(20)22/h2-16,27H,1H3,(H,25,29) |
| InChIKey | QJYGVLIEMDURTN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|