C23H16N2O3 — CID 124550712
3-[[(Z)-2-cyano-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 124550712) has the molecular formula C23H16N2O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 124550712 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/c1ccc(-c2ccccc2)cc1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H16N2O3/c24-15-20(22(26)25-21-8-4-7-19(14-21)23(27)28)13-16-9-11-18(12-10-16)17-5-2-1-3-6-17/h1-14H,(H,25,26)(H,27,28)/b20-13- |
| InChIKey | CVUZWFMSKSNEOX-MOSHPQCFSA-N |
| XLogP | 4.60 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|