C18H12Br2N2O4 — CID 124550728
3-[[(Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 124550728) has the molecular formula C18H12Br2N2O4 and a molecular weight of 480.11 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 124550728 |
| Molecular Formula | C18H12Br2N2O4 |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 477.92 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1c(Br)cc(/C=C(/C#N)C(=O)Nc2cccc(C(=O)O)c2)cc1Br |
| InChI | InChI=1S/C18H12Br2N2O4/c1-26-16-14(19)6-10(7-15(16)20)5-12(9-21)17(23)22-13-4-2-3-11(8-13)18(24)25/h2-8H,1H3,(H,22,23)(H,24,25)/b12-5- |
| InChIKey | SNQGDJORNUFNAZ-XGICHPGQSA-N |
| XLogP | 4.46 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|