C20H14BrClN2O6 — CID 3266513
3-[[3-[3-bromo-5-chloro-4-(2-methoxy-2-oxoethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 3266513) has the molecular formula C20H14BrClN2O6 and a molecular weight of 493.70 g/mol. Its IUPAC name is 3-[[3-[3-bromo-5-chloro-4-(2-methoxy-2-oxoethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[3-[3-bromo-5-chloro-4-(2-methoxy-2-oxoethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3266513 |
| Molecular Formula | C20H14BrClN2O6 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | 3-[[3-[3-bromo-5-chloro-4-(2-methoxy-2-oxoethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | COC(=O)COc1c(Cl)cc(C=C(C#N)C(=O)Nc2cccc(C(=O)O)c2)cc1Br |
| InChI | InChI=1S/C20H14BrClN2O6/c1-29-17(25)10-30-18-15(21)6-11(7-16(18)22)5-13(9-23)19(26)24-14-4-2-3-12(8-14)20(27)28/h2-8H,10H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | RGPKIOGFTPDJAQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|