C20H14Br2Cl2N2O4 — CID 124534549
ethyl 2-[2,6-dibromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate (PubChem CID 124534549) has the molecular formula C20H14Br2Cl2N2O4 and a molecular weight of 577.06 g/mol. Its IUPAC name is ethyl 2-[2,6-dibromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dibromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 124534549 |
| Molecular Formula | C20H14Br2Cl2N2O4 |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 573.87 |
| IUPAC Name | ethyl 2-[2,6-dibromo-4-[(Z)-2-cyano-3-(2,3-dichloroanilino)-3-oxoprop-1-enyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)cc1Br |
| InChI | InChI=1S/C20H14Br2Cl2N2O4/c1-2-29-17(27)10-30-19-13(21)7-11(8-14(19)22)6-12(9-25)20(28)26-16-5-3-4-15(23)18(16)24/h3-8H,2,10H2,1H3,(H,26,28)/b12-6- |
| InChIKey | CDDOORQNNVRSQS-SDQBBNPISA-N |
| XLogP | 6.01 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|