C26H18BrCl3N2O2 — CID 124534736
(Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-prop-2-enylphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 124534736) has the molecular formula C26H18BrCl3N2O2 and a molecular weight of 576.71 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-prop-2-enylphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-prop-2-enylphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 124534736 |
| Molecular Formula | C26H18BrCl3N2O2 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 573.96 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-prop-2-enylphenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H18BrCl3N2O2/c1-2-6-17-11-16(13-20(27)25(17)34-15-18-7-3-4-8-21(18)28)12-19(14-31)26(33)32-23-10-5-9-22(29)24(23)30/h2-5,7-13H,1,6,15H2,(H,32,33)/b19-12- |
| InChIKey | JKLSUGPVNNJPNH-UNOMPAQXSA-N |
| XLogP | 8.26 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|