C35H41N5O3 — CID 66915004
N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(3-ethoxypropyl)-5-methyl-3-phenylpyrrol-2-yl]-2-oxoacetamide (PubChem CID 66915004) has the molecular formula C35H41N5O3 and a molecular weight of 579.75 g/mol. Its IUPAC name is N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(3-ethoxypropyl)-5-methyl-3-phenylpyrrol-2-yl]-2-oxoacetamide.
| Compound Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(3-ethoxypropyl)-5-methyl-3-phenylpyrrol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 66915004 |
| Molecular Formula | C35H41N5O3 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.32 |
| IUPAC Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(3-ethoxypropyl)-5-methyl-3-phenylpyrrol-2-yl]-2-oxoacetamide |
| SMILES | CCOCCCn1c(C)cc(-c2ccccc2)c1C(=O)C(=O)Nc1ccc(N2CCN(c3cc(C)cc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C35H41N5O3/c1-5-43-21-9-16-40-27(4)24-31(28-10-7-6-8-11-28)33(40)34(41)35(42)37-29-12-14-30(15-13-29)38-17-19-39(20-18-38)32-23-25(2)22-26(3)36-32/h6-8,10-15,22-24H,5,9,16-21H2,1-4H3,(H,37,42) |
| InChIKey | GYXAHESIJARWQD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|