C34H37N5O4 — CID 66914978
ethyl 2-[2-[2-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]anilino]-2-oxoacetyl]-5-methyl-3-phenylpyrrol-1-yl]acetate (PubChem CID 66914978) has the molecular formula C34H37N5O4 and a molecular weight of 579.70 g/mol. Its IUPAC name is ethyl 2-[2-[2-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]anilino]-2-oxoacetyl]-5-methyl-3-phenylpyrrol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]anilino]-2-oxoacetyl]-5-methyl-3-phenylpyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 66914978 |
| Molecular Formula | C34H37N5O4 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | ethyl 2-[2-[2-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]anilino]-2-oxoacetyl]-5-methyl-3-phenylpyrrol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)cc(-c2ccccc2)c1C(=O)C(=O)Nc1ccc(N2CCN(c3cc(C)cc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C34H37N5O4/c1-5-43-31(40)22-39-25(4)21-29(26-9-7-6-8-10-26)32(39)33(41)34(42)36-27-11-13-28(14-12-27)37-15-17-38(18-16-37)30-20-23(2)19-24(3)35-30/h6-14,19-21H,5,15-18,22H2,1-4H3,(H,36,42) |
| InChIKey | IRIMGNMBSWGZCI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|