C36H42N6O4 — CID 67239111
2-[1-(2-methoxyethyl)-5-methyl-3-phenylpyrrol-2-yl]-N-[4-[4-[5-(morpholin-4-ylmethyl)-2-pyridinyl]piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 67239111) has the molecular formula C36H42N6O4 and a molecular weight of 622.77 g/mol. Its IUPAC name is 2-[1-(2-methoxyethyl)-5-methyl-3-phenylpyrrol-2-yl]-N-[4-[4-[5-(morpholin-4-ylmethyl)-2-pyridinyl]piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-[1-(2-methoxyethyl)-5-methyl-3-phenylpyrrol-2-yl]-N-[4-[4-[5-(morpholin-4-ylmethyl)-2-pyridinyl]piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 67239111 |
| Molecular Formula | C36H42N6O4 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 2-[1-(2-methoxyethyl)-5-methyl-3-phenylpyrrol-2-yl]-N-[4-[4-[5-(morpholin-4-ylmethyl)-2-pyridinyl]piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | COCCn1c(C)cc(-c2ccccc2)c1C(=O)C(=O)Nc1ccc(N2CCN(c3ccc(CN4CCOCC4)cn3)CC2)cc1 |
| InChI | InChI=1S/C36H42N6O4/c1-27-24-32(29-6-4-3-5-7-29)34(42(27)20-21-45-2)35(43)36(44)38-30-9-11-31(12-10-30)40-14-16-41(17-15-40)33-13-8-28(25-37-33)26-39-18-22-46-23-19-39/h3-13,24-25H,14-23,26H2,1-2H3,(H,38,44) |
| InChIKey | MLJORNLOAIXZFX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|