C32H33N5O2 — CID 25119919
N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)acetamide (PubChem CID 25119919) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)acetamide.
| Compound Name | N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)acetamide |
|---|---|
| PubChem CID | 25119919 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | N-[4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxo-2-(2-phenyl-5,6,7,8-tetrahydroindolizin-3-yl)acetamide |
| SMILES | Cc1ccc(N2CCN(c3ccc(NC(=O)C(=O)c4c(-c5ccccc5)cc5n4CCCC5)cc3)CC2)nc1 |
| InChI | InChI=1S/C32H33N5O2/c1-23-10-15-29(33-22-23)36-19-17-35(18-20-36)26-13-11-25(12-14-26)34-32(39)31(38)30-28(24-7-3-2-4-8-24)21-27-9-5-6-16-37(27)30/h2-4,7-8,10-15,21-22H,5-6,9,16-20H2,1H3,(H,34,39) |
| InChIKey | ZPHDLXDDOCWQES-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|