C31H33N5O3 — CID 66914698
N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(methoxymethyl)-3-phenylpyrrol-2-yl]-2-oxoacetamide (PubChem CID 66914698) has the molecular formula C31H33N5O3 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(methoxymethyl)-3-phenylpyrrol-2-yl]-2-oxoacetamide.
| Compound Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(methoxymethyl)-3-phenylpyrrol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 66914698 |
| Molecular Formula | C31H33N5O3 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[1-(methoxymethyl)-3-phenylpyrrol-2-yl]-2-oxoacetamide |
| SMILES | COCn1ccc(-c2ccccc2)c1C(=O)C(=O)Nc1ccc(N2CCN(c3cc(C)cc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C31H33N5O3/c1-22-19-23(2)32-28(20-22)35-17-15-34(16-18-35)26-11-9-25(10-12-26)33-31(38)30(37)29-27(13-14-36(29)21-39-3)24-7-5-4-6-8-24/h4-14,19-20H,15-18,21H2,1-3H3,(H,33,38) |
| InChIKey | CZFYAINLKMHXMH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|