C36H36N6O2 — CID 67238945
N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[5-methyl-3-[phenyl(pyridin-3-yl)methyl]-1H-pyrrol-2-yl]-2-oxoacetamide (PubChem CID 67238945) has the molecular formula C36H36N6O2 and a molecular weight of 584.72 g/mol. Its IUPAC name is N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[5-methyl-3-[phenyl(pyridin-3-yl)methyl]-1H-pyrrol-2-yl]-2-oxoacetamide.
| Compound Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[5-methyl-3-[phenyl(pyridin-3-yl)methyl]-1H-pyrrol-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 67238945 |
| Molecular Formula | C36H36N6O2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | N-[4-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-[5-methyl-3-[phenyl(pyridin-3-yl)methyl]-1H-pyrrol-2-yl]-2-oxoacetamide |
| SMILES | Cc1cc(C)nc(N2CCN(c3ccc(NC(=O)C(=O)c4[nH]c(C)cc4C(c4ccccc4)c4cccnc4)cc3)CC2)c1 |
| InChI | InChI=1S/C36H36N6O2/c1-24-20-25(2)38-32(21-24)42-18-16-41(17-19-42)30-13-11-29(12-14-30)40-36(44)35(43)34-31(22-26(3)39-34)33(27-8-5-4-6-9-27)28-10-7-15-37-23-28/h4-15,20-23,33,39H,16-19H2,1-3H3,(H,40,44) |
| InChIKey | MSVIXKZWLADWHR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|