C34H39N5O2 — CID 67107495
2-(2-cyclohexylindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)-1,4-diazepan-1-yl]phenyl]-2-oxoacetamide (PubChem CID 67107495) has the molecular formula C34H39N5O2 and a molecular weight of 549.72 g/mol. Its IUPAC name is 2-(2-cyclohexylindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)-1,4-diazepan-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(2-cyclohexylindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)-1,4-diazepan-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 67107495 |
| Molecular Formula | C34H39N5O2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 2-(2-cyclohexylindolizin-3-yl)-N-[4-[4-(4,6-dimethyl-2-pyridinyl)-1,4-diazepan-1-yl]phenyl]-2-oxoacetamide |
| SMILES | Cc1cc(C)nc(N2CCCN(c3ccc(NC(=O)C(=O)c4c(C5CCCCC5)cc5ccccn45)cc3)CC2)c1 |
| InChI | InChI=1S/C34H39N5O2/c1-24-21-25(2)35-31(22-24)38-17-8-16-37(19-20-38)28-14-12-27(13-15-28)36-34(41)33(40)32-30(26-9-4-3-5-10-26)23-29-11-6-7-18-39(29)32/h6-7,11-15,18,21-23,26H,3-5,8-10,16-17,19-20H2,1-2H3,(H,36,41) |
| InChIKey | QBUKOYMXVXCKOG-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|