C32H35N5O2 — CID 67106927
2-(2-cyclopentylindolizin-3-yl)-N-[4-[4-(6-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 67106927) has the molecular formula C32H35N5O2 and a molecular weight of 521.67 g/mol. Its IUPAC name is 2-(2-cyclopentylindolizin-3-yl)-N-[4-[4-(6-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(2-cyclopentylindolizin-3-yl)-N-[4-[4-(6-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 67106927 |
| Molecular Formula | C32H35N5O2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 2-(2-cyclopentylindolizin-3-yl)-N-[4-[4-(6-ethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | CCc1cccc(N2CCN(c3ccc(NC(=O)C(=O)c4c(C5CCCC5)cc5ccccn45)cc3)CC2)n1 |
| InChI | InChI=1S/C32H35N5O2/c1-2-24-10-7-12-29(33-24)36-20-18-35(19-21-36)26-15-13-25(14-16-26)34-32(39)31(38)30-28(23-8-3-4-9-23)22-27-11-5-6-17-37(27)30/h5-7,10-17,22-23H,2-4,8-9,18-21H2,1H3,(H,34,39) |
| InChIKey | WMXCLMMRPFOFBJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|