C30H42N4O2 — CID 25121318
2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2,2-dimethylpropyl)piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 25121318) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is 2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2,2-dimethylpropyl)piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2,2-dimethylpropyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 25121318 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 2-(2-cyclopentyl-5,6,7,8-tetrahydroindolizin-3-yl)-N-[4-[4-(2,2-dimethylpropyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | CC(C)(C)CN1CCN(c2ccc(NC(=O)C(=O)c3c(C4CCCC4)cc4n3CCCC4)cc2)CC1 |
| InChI | InChI=1S/C30H42N4O2/c1-30(2,3)21-32-16-18-33(19-17-32)24-13-11-23(12-14-24)31-29(36)28(35)27-26(22-8-4-5-9-22)20-25-10-6-7-15-34(25)27/h11-14,20,22H,4-10,15-19,21H2,1-3H3,(H,31,36) |
| InChIKey | FMVXSNQSABLHIM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|