C18H26N4O2 — CID 108505990
N-cyclopentyl-N'-[4-(4-methylpiperazin-1-yl)phenyl]oxamide (PubChem CID 108505990) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-cyclopentyl-N'-[4-(4-methylpiperazin-1-yl)phenyl]oxamide.
| Compound Name | N-cyclopentyl-N'-[4-(4-methylpiperazin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 108505990 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-cyclopentyl-N'-[4-(4-methylpiperazin-1-yl)phenyl]oxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)C(=O)NC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C18H26N4O2/c1-21-10-12-22(13-11-21)16-8-6-15(7-9-16)20-18(24)17(23)19-14-4-2-3-5-14/h6-9,14H,2-5,10-13H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | BXXAPYHYOPKKFX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|