C16H21N3O4S — CID 7627719
N-cyclopentyl-N'-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide (PubChem CID 7627719) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-cyclopentyl-N'-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide.
| Compound Name | N-cyclopentyl-N'-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 7627719 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-cyclopentyl-N'-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]oxamide |
| SMILES | O=C(Nc1ccc(N2CCCS2(=O)=O)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H21N3O4S/c20-15(17-12-4-1-2-5-12)16(21)18-13-6-8-14(9-7-13)19-10-3-11-24(19,22)23/h6-9,12H,1-5,10-11H2,(H,17,20)(H,18,21) |
| InChIKey | YAPOTLUNBXARCL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|