C18H26ClN3O3S — CID 119276622
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119276622) has the molecular formula C18H26ClN3O3S and a molecular weight of 399.94 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119276622 |
| Molecular Formula | C18H26ClN3O3S |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(N2CCCS2(=O)=O)cc1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C18H25N3O3S.ClH/c22-18(17-12-13-4-1-2-5-16(13)20-17)19-14-6-8-15(9-7-14)21-10-3-11-25(21,23)24;/h6-9,13,16-17,20H,1-5,10-12H2,(H,19,22);1H |
| InChIKey | SIRNMJKENATFSZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |