C15H21N3O3S — CID 119276641
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]piperidine-3-carboxamide (PubChem CID 119276641) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119276641 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCS2(=O)=O)cc1)C1CCCNC1 |
| InChI | InChI=1S/C15H21N3O3S/c19-15(12-3-1-8-16-11-12)17-13-4-6-14(7-5-13)18-9-2-10-22(18,20)21/h4-7,12,16H,1-3,8-11H2,(H,17,19) |
| InChIKey | DDQHDPRFRCYMNC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |