C17H25N3O — CID 81119070
(3S)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]piperidine-3-carboxamide (PubChem CID 81119070) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (3S)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81119070 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (3S)-N-[4-(pyrrolidin-1-ylmethyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(CN2CCCC2)cc1)[C@H]1CCCNC1 |
| InChI | InChI=1S/C17H25N3O/c21-17(15-4-3-9-18-12-15)19-16-7-5-14(6-8-16)13-20-10-1-2-11-20/h5-8,15,18H,1-4,9-13H2,(H,19,21)/t15-/m0/s1 |
| InChIKey | PDXCYRMJNVSVEZ-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |