C19H20F2N2O — CID 45019225
N-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 45019225) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45019225 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20F2N2O/c20-16-3-1-14(2-4-16)13-23-11-9-15(10-12-23)19(24)22-18-7-5-17(21)6-8-18/h1-8,15H,9-13H2,(H,22,24) |
| InChIKey | NFPVWCUXWUOAHM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |