C23H28FN3O2 — CID 108760674
N'-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanediamide (PubChem CID 108760674) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanediamide.
| Compound Name | N'-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanediamide |
|---|---|
| PubChem CID | 108760674 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N'-(4-fluorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]butanediamide |
| SMILES | CC1CCN(Cc2ccc(NC(=O)CCC(=O)Nc3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-17-12-14-27(15-13-17)16-18-2-6-20(7-3-18)25-22(28)10-11-23(29)26-21-8-4-19(24)5-9-21/h2-9,17H,10-16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | LDSGMTBCKAQWEZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |