C22H29N3O3S — CID 60517587
3-(benzenesulfonamido)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]propanamide (PubChem CID 60517587) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 60517587 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]propanamide |
| SMILES | CC1CCN(Cc2ccc(NC(=O)CCNS(=O)(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-18-12-15-25(16-13-18)17-19-7-9-20(10-8-19)24-22(26)11-14-23-29(27,28)21-5-3-2-4-6-21/h2-10,18,23H,11-17H2,1H3,(H,24,26) |
| InChIKey | IXRJEHDAQAKJOO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |