C18H20FN3O — CID 40921983
1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpiperidine-4-carboxamide (PubChem CID 40921983) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpiperidine-4-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 40921983 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H20FN3O/c19-16-5-3-14(4-6-16)13-22-10-7-15(8-11-22)18(23)21-17-2-1-9-20-12-17/h1-6,9,12,15H,7-8,10-11,13H2,(H,21,23) |
| InChIKey | AHBHASVWWQQSFH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |