C17H18FN3O — CID 136512014
1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide (PubChem CID 136512014) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 136512014 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1CCCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O/c18-14-7-5-13(6-8-14)12-21-10-2-4-16(21)17(22)20-15-3-1-9-19-11-15/h1,3,5-9,11,16H,2,4,10,12H2,(H,20,22) |
| InChIKey | BWBGKIXTNFWKSS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |