C10H12FN3O — CID 140521967
1-fluoro-N-pyridin-3-ylpyrrolidine-2-carboxamide (PubChem CID 140521967) has the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. Its IUPAC name is 1-fluoro-N-pyridin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-fluoro-N-pyridin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140521967 |
| Molecular Formula | C10H12FN3O |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-fluoro-N-pyridin-3-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1CCCN1F |
| InChI | InChI=1S/C10H12FN3O/c11-14-6-2-4-9(14)10(15)13-8-3-1-5-12-7-8/h1,3,5,7,9H,2,4,6H2,(H,13,15) |
| InChIKey | LTZJHXBOKFOCHR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|