C19H21N5O4 — CID 175120523
1-[[(4-methoxybenzoyl)amino]carbamoyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide (PubChem CID 175120523) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-[[(4-methoxybenzoyl)amino]carbamoyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[[(4-methoxybenzoyl)amino]carbamoyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175120523 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-[[(4-methoxybenzoyl)amino]carbamoyl]-N-pyridin-3-ylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)NNC(=O)N2CCCC2C(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C19H21N5O4/c1-28-15-8-6-13(7-9-15)17(25)22-23-19(27)24-11-3-5-16(24)18(26)21-14-4-2-10-20-12-14/h2,4,6-10,12,16H,3,5,11H2,1H3,(H,21,26)(H,22,25)(H,23,27) |
| InChIKey | MEVFEUXSANBQLQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|