C18H21N3O3 — CID 92800272
(2R)-2-(2,4-dimethoxyphenyl)-N-pyridin-3-ylpyrrolidine-1-carboxamide (PubChem CID 92800272) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethoxyphenyl)-N-pyridin-3-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-(2,4-dimethoxyphenyl)-N-pyridin-3-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 92800272 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2R)-2-(2,4-dimethoxyphenyl)-N-pyridin-3-ylpyrrolidine-1-carboxamide |
| SMILES | COc1ccc([C@H]2CCCN2C(=O)Nc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-23-14-7-8-15(17(11-14)24-2)16-6-4-10-21(16)18(22)20-13-5-3-9-19-12-13/h3,5,7-9,11-12,16H,4,6,10H2,1-2H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | FRSRWJBLBBPNAA-MRXNPFEDSA-N |
| XLogP | 3.47 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |