C19H21N3O5 — CID 39972982
(2R)-2-(2,4-dimethoxyphenyl)-N-(4-nitrophenyl)pyrrolidine-1-carboxamide (PubChem CID 39972982) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethoxyphenyl)-N-(4-nitrophenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-(2,4-dimethoxyphenyl)-N-(4-nitrophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 39972982 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (2R)-2-(2,4-dimethoxyphenyl)-N-(4-nitrophenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc([C@H]2CCCN2C(=O)Nc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C19H21N3O5/c1-26-15-9-10-16(18(12-15)27-2)17-4-3-11-21(17)19(23)20-13-5-7-14(8-6-13)22(24)25/h5-10,12,17H,3-4,11H2,1-2H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | IMAHMRMXUCQIOC-QGZVFWFLSA-N |
| XLogP | 3.98 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|