C20H22N2O6 — CID 42026214
1-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-(2-nitrophenoxy)ethanone (PubChem CID 42026214) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 1-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-(2-nitrophenoxy)ethanone.
| Compound Name | 1-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-(2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 42026214 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-(2-nitrophenoxy)ethanone |
| SMILES | COc1ccc([C@@H]2CCCN2C(=O)COc2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C20H22N2O6/c1-26-14-9-10-15(19(12-14)27-2)16-7-5-11-21(16)20(23)13-28-18-8-4-3-6-17(18)22(24)25/h3-4,6,8-10,12,16H,5,7,11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | FJEPIQHNOZXNOP-INIZCTEOSA-N |
| XLogP | 3.35 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|