C21H25NO4 — CID 124843390
2-(2-methoxyphenoxy)-1-[(2R)-2-(3-methoxyphenyl)piperidin-1-yl]ethanone (PubChem CID 124843390) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-1-[(2R)-2-(3-methoxyphenyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(2-methoxyphenoxy)-1-[(2R)-2-(3-methoxyphenyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124843390 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-(2-methoxyphenoxy)-1-[(2R)-2-(3-methoxyphenyl)piperidin-1-yl]ethanone |
| SMILES | COc1cccc([C@H]2CCCCN2C(=O)COc2ccccc2OC)c1 |
| InChI | InChI=1S/C21H25NO4/c1-24-17-9-7-8-16(14-17)18-10-5-6-13-22(18)21(23)15-26-20-12-4-3-11-19(20)25-2/h3-4,7-9,11-12,14,18H,5-6,10,13,15H2,1-2H3/t18-/m1/s1 |
| InChIKey | DQHBTRQCHRUNSF-GOSISDBHSA-N |
| XLogP | 3.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |