C24H30N2O2 — CID 51688220
1-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylpiperidin-1-yl)ethanone (PubChem CID 51688220) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylpiperidin-1-yl)ethanone.
| Compound Name | 1-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 51688220 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-(4-phenylpiperidin-1-yl)ethanone |
| SMILES | COc1cccc([C@H]2CCCN2C(=O)CN2CCC(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H30N2O2/c1-28-22-10-5-9-21(17-22)23-11-6-14-26(23)24(27)18-25-15-12-20(13-16-25)19-7-3-2-4-8-19/h2-5,7-10,17,20,23H,6,11-16,18H2,1H3/t23-/m1/s1 |
| InChIKey | IBHBFFHRRHTPCS-HSZRJFAPSA-N |
| XLogP | 4.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |