C16H23N3O3 — CID 94454003
2-[[2-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-methylamino]acetamide (PubChem CID 94454003) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[[2-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-methylamino]acetamide.
| Compound Name | 2-[[2-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 94454003 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-[[2-[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-methylamino]acetamide |
| SMILES | COc1cccc([C@H]2CCCN2C(=O)CN(C)CC(N)=O)c1 |
| InChI | InChI=1S/C16H23N3O3/c1-18(10-15(17)20)11-16(21)19-8-4-7-14(19)12-5-3-6-13(9-12)22-2/h3,5-6,9,14H,4,7-8,10-11H2,1-2H3,(H2,17,20)/t14-/m1/s1 |
| InChIKey | MOFYXQMHSRNYBF-CQSZACIVSA-N |
| XLogP | 0.78 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |