C13H15N2O3- — CID 6950908
trans-(1S,2S)-2-(pyridin-3-ylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 6950908) has the molecular formula C13H15N2O3- and a molecular weight of 247.27 g/mol. Its IUPAC name is trans-(1S,2S)-2-(pyridin-3-ylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-(pyridin-3-ylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6950908 |
| Molecular Formula | C13H15N2O3- |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | trans-(1S,2S)-2-(pyridin-3-ylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCC[C@@H]1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C13H16N2O3/c16-12(15-9-4-3-7-14-8-9)10-5-1-2-6-11(10)13(17)18/h3-4,7-8,10-11H,1-2,5-6H2,(H,15,16)(H,17,18)/p-1/t10-,11-/m0/s1 |
| InChIKey | AFWWQUGLCPAHPY-QWRGUYRKSA-M |
| XLogP | 0.58 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |