C15H15NO5-2 — CID 6944194
4-[[(1R,2R)-2-carboxylatocyclohexanecarbonyl]amino]benzoate (PubChem CID 6944194) has the molecular formula C15H15NO5-2 and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-carboxylatocyclohexanecarbonyl]amino]benzoate.
| Compound Name | 4-[[(1R,2R)-2-carboxylatocyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 6944194 |
| Molecular Formula | C15H15NO5-2 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-[[(1R,2R)-2-carboxylatocyclohexanecarbonyl]amino]benzoate |
| SMILES | O=C([O-])c1ccc(NC(=O)[C@@H]2CCCC[C@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C15H17NO5/c17-13(11-3-1-2-4-12(11)15(20)21)16-10-7-5-9(6-8-10)14(18)19/h5-8,11-12H,1-4H2,(H,16,17)(H,18,19)(H,20,21)/p-2/t11-,12-/m1/s1 |
| InChIKey | ULAUXEJKVWFIPU-VXGBXAGGSA-L |
| XLogP | -0.46 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |