C21H22NO4- — CID 4990951
2-[[4-(4-methylphenoxy)phenyl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 4990951) has the molecular formula C21H22NO4- and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[[4-(4-methylphenoxy)phenyl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | 2-[[4-(4-methylphenoxy)phenyl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 4990951 |
| Molecular Formula | C21H22NO4- |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[[4-(4-methylphenoxy)phenyl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)C3CCCCC3C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-14-6-10-16(11-7-14)26-17-12-8-15(9-13-17)22-20(23)18-4-2-3-5-19(18)21(24)25/h6-13,18-19H,2-5H2,1H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | OPLVUCABQYYYSV-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |