C24H22N2O3 — CID 109141175
2-N-(4-methylphenyl)-1-N-(4-phenoxyphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109141175) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-N-(4-methylphenyl)-1-N-(4-phenoxyphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-(4-methylphenyl)-1-N-(4-phenoxyphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109141175 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-N-(4-methylphenyl)-1-N-(4-phenoxyphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC2C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O3/c1-16-7-9-17(10-8-16)25-23(27)21-15-22(21)24(28)26-18-11-13-20(14-12-18)29-19-5-3-2-4-6-19/h2-14,21-22H,15H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | PZCFTBMZAISLEQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |