C14H15INO3- — CID 7312282
trans-(1R,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 7312282) has the molecular formula C14H15INO3- and a molecular weight of 372.18 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7312282 |
| Molecular Formula | C14H15INO3- |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | trans-(1R,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCC[C@H]1C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C14H16INO3/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(18)19/h5-8,11-12H,1-4H2,(H,16,17)(H,18,19)/p-1/t11-,12-/m1/s1 |
| InChIKey | YNZREWFCOGDFND-VXGBXAGGSA-M |
| XLogP | 1.79 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|