C14H16INO3 — CID 7312287
cis-(1S,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 7312287) has the molecular formula C14H16INO3 and a molecular weight of 373.19 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 7312287 |
| Molecular Formula | C14H16INO3 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | cis-(1S,2R)-2-[(4-iodophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCC[C@H]1C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C14H16INO3/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(18)19/h5-8,11-12H,1-4H2,(H,16,17)(H,18,19)/t11-,12+/m1/s1 |
| InChIKey | YNZREWFCOGDFND-NEPJUHHUSA-N |
| XLogP | 3.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|