C18H18NO3- — CID 6991180
trans-(1R,2R)-2-(naphthalen-2-ylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 6991180) has the molecular formula C18H18NO3- and a molecular weight of 296.35 g/mol. Its IUPAC name is trans-(1R,2R)-2-(naphthalen-2-ylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,2R)-2-(naphthalen-2-ylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6991180 |
| Molecular Formula | C18H18NO3- |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | trans-(1R,2R)-2-(naphthalen-2-ylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCC[C@H]1C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H19NO3/c20-17(15-7-3-4-8-16(15)18(21)22)19-14-10-9-12-5-1-2-6-13(12)11-14/h1-2,5-6,9-11,15-16H,3-4,7-8H2,(H,19,20)(H,21,22)/p-1/t15-,16-/m1/s1 |
| InChIKey | HWPAEJWYKJFXBY-HZPDHXFCSA-M |
| XLogP | 2.33 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |